352525-94-1 Usage
Description
3-Aminomethylphenylboronic acid hydrochloride, also known as 3-(Aminomethyl)benzeneboronic acid hydrochloride, is an organic compound that belongs to the class of arylboronic acids. It is characterized by the presence of a boron atom bonded to a phenyl ring with an aminomethyl group attached to the 3rd position. 3-Aminomethylphenylboronic acid hydrochloride is known for its role as an intermediate in various chemical reactions and holds potential applications in different industries due to its unique chemical properties.
Uses
Used in Chemical Synthesis:
3-Aminomethylphenylboronic acid hydrochloride is used as an intermediate in the synthesis of various organic compounds. Its ability to participate in Suzuki-Miyaura reactions, a type of cross-coupling reaction, makes it a valuable component in the formation of new carbon-carbon bonds, which are essential in the development of complex molecular structures.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3-Aminomethylphenylboronic acid hydrochloride is utilized as a building block for the development of new drugs. Its unique structure allows it to be incorporated into various drug candidates, potentially leading to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Used as a Catalyst:
3-Aminomethylphenylboronic acid hydrochloride can be employed as an effective catalyst for amidation and esterification reactions involving carboxylic acids. Its ability to facilitate these reactions can lead to the production of various pharmaceuticals, agrochemicals, and other specialty chemicals that require the formation of amide and ester functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 352525-94-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,2 and 5 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 352525-94:
(8*3)+(7*5)+(6*2)+(5*5)+(4*2)+(3*5)+(2*9)+(1*4)=141
141 % 10 = 1
So 352525-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H10BNO2.ClH/c9-5-6-2-1-3-7(4-6)8(10)11;/h1-4,10-11H,5,9H2;1H
