352526-01-3 Usage
Description
3-Mercaptophenylboronic acid is an organic compound that features a boronic acid group attached to a phenyl ring with a thiol (-SH) group at the 3rd position. This unique structure endows it with specific chemical properties and reactivity, making it a versatile molecule for various applications in different industries.
Uses
Used in Analytical Chemistry:
3-Mercaptophenylboronic acid is used as a modifier for amperometric biosensors for hydrogen peroxide. Its ability to form stable complexes with sugars and other compounds containing hydroxyl groups enhances the sensitivity and selectivity of these sensors, making it a valuable component in the development of analytical tools for detecting hydrogen peroxide and other relevant analytes.
Used in Nanotechnology:
3-Mercaptophenylboronic acid serves as a protective agent for silver nanoclusters. The thiol group in the molecule can coordinate with silver atoms, providing a stabilizing effect and preventing aggregation of the nanoclusters. This property is crucial in the synthesis and application of silver nanoclusters, which have potential uses in various fields, including catalysis, sensing, and antimicrobial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 352526-01-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,2 and 6 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 352526-01:
(8*3)+(7*5)+(6*2)+(5*5)+(4*2)+(3*6)+(2*0)+(1*1)=123
123 % 10 = 3
So 352526-01-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BO2S/c8-7(9)5-2-1-3-6(10)4-5/h1-4,8-10H
