352535-83-2 Usage
Description
5-CHLORO-2-FLUOROPHENYLBORONIC ACID is an organic compound that serves as an essential reagent in various chemical reactions and synthesis processes. It is characterized by its unique structure, which includes a boron atom bonded to a phenyl group with a chlorine and a fluorine atom at specific positions. 5-CHLORO-2-FLUOROPHENYLBORONIC ACID is known for its role in the formation of carbon-carbon bonds and its ability to participate in cross-coupling reactions, making it a valuable component in the synthesis of complex organic molecules.
Uses
Used in Pharmaceutical Industry:
5-CHLORO-2-FLUOROPHENYLBORONIC ACID is used as a reactant for the synthesis of various pharmaceutical compounds, such as biaryl amides with muscarinic acetylcholine receptor subtype M1 agonistic activity. This application is crucial for the development of new drugs targeting specific receptors, which can lead to more effective treatments for various medical conditions.
Used in Chemical Synthesis:
5-CHLORO-2-FLUOROPHENYLBORONIC ACID is used as a reactant in Suzuki cross-coupling reactions, a widely employed method for the formation of carbon-carbon bonds. This reaction is essential in the synthesis of complex organic molecules, including those with potential applications in various industries such as pharmaceuticals, agrochemicals, and materials science.
Used in the Synthesis of Kinesin Spindle Protein Inhibitors:
5-CHLORO-2-FLUOROPHENYLBORONIC ACID is used as a reactant in the preparation of kinesin spindle protein inhibitors. These inhibitors play a vital role in the development of new cancer therapeutics, as they can disrupt the normal functioning of cancer cells and potentially halt their growth and proliferation.
Used in the Preparation of GABA α2/3 Agonists:
5-CHLORO-2-FLUOROPHENYLBORONIC ACID is used as a reactant in the synthesis of GABA α2/3 agonists, which are compounds that can activate the GABA α2/3 receptors. These agonists have potential applications in the treatment of various neurological and psychiatric disorders, such as epilepsy, anxiety, and depression.
Check Digit Verification of cas no
The CAS Registry Mumber 352535-83-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,5,2,5,3 and 5 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 352535-83:
(8*3)+(7*5)+(6*2)+(5*5)+(4*3)+(3*5)+(2*8)+(1*3)=142
142 % 10 = 2
So 352535-83-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H5BClFO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H
352535-83-2Relevant articles and documents
NEW COMPOUNDS AND ORGANIC LIGHT EMITTING DEVICE USING THE SAME
-
Paragraph 0110-0113, (2017/04/19)
The present invention relates to a novel compound and an organic luminescent device containing the novel compound in an organic compound layer, wherein the compound improves the life, efficiency, electrochemical stability, and thermal stability of the organic luminescent device. In chemical formula 1, R1 and R2 are selected from a group consisting of an alkyl group having 1-10 carbons and an aryl group having 6-30 carbons.
Design and application of a low-temperature continuous flow chemistry platform
Newby, James A.,Blaylock, D. Wayne,Witt, Paul M.,Pastre, Julio C.,Zacharova, Marija K.,Ley, Steven V.,Browne, Duncan L.
, p. 1211 - 1220 (2014/12/10)
A flow reactor platform technology applicable to a broad range of low temperature chemistry is reported. The newly developed system captures the essence of running low temperature reactions in batch and represents this as a series of five flow coils, each with independently variable volume. The system was initially applied to the functionalization of alkynes, Grignard addition reactions, heterocycle functionalization, and heteroatom acetylation. This new platform has then been used in the preparation of a 20-compound library of polysubstituted, fluorine-containing aromatic substrates from a sequential metalation-quench procedure and can be readily adapted to provide gaseous electrophile inputs such as carbon dioxide using a tube-in-tube reactor.