35359-23-0 Usage
General Description
[1,2,4]Triazolo[4,3-a]quinoline-1-thiol is a chemical compound with a unique and complex structure. It belongs to the class of heterocyclic compounds and contains a triazoloquinoline ring system with a thiol group attached to the first position. [1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL has potential applications in various fields such as pharmaceuticals, agrochemicals, and materials science. The presence of the triazoloquinoline ring system and the thiol group gives this compound interesting and valuable properties, making it a subject of interest for further research and development. Its unique structure and potential uses make it an important compound in the field of chemistry and related industries.
Check Digit Verification of cas no
The CAS Registry Mumber 35359-23-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,5 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 35359-23:
(7*3)+(6*5)+(5*3)+(4*5)+(3*9)+(2*2)+(1*3)=120
120 % 10 = 0
So 35359-23-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3S/c14-10-12-11-9-6-5-7-3-1-2-4-8(7)13(9)10/h1-6H,(H,12,14)
