35359-27-4 Usage
Description
5-METHYL-[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is an organic compound characterized by its unique molecular structure, which features a thiol group attached to a quinoline ring fused with a triazole ring. 5-METHYL-[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is known for its potential applications in various chemical and pharmaceutical processes due to its versatile chemical properties.
Uses
Used in Chemical Synthesis:
5-METHYL-[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is used as a reactant in the preparation of polyazaindenes and related compounds. Its presence in these reactions contributes to the formation of complex organic molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-METHYL-[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL may be utilized as a building block or intermediate in the synthesis of novel drug candidates. Its unique structure could provide new avenues for the development of therapeutic agents with specific target interactions and improved pharmacological properties.
Used in Research and Development:
5-METHYL-[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL is also used in research and development settings to explore its chemical reactivity and potential applications in various fields. Scientists and researchers can leverage its properties to create new compounds or improve existing ones, leading to advancements in material science, medicinal chemistry, and other related disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 35359-27-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,5,3,5 and 9 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 35359-27:
(7*3)+(6*5)+(5*3)+(4*5)+(3*9)+(2*2)+(1*7)=124
124 % 10 = 4
So 35359-27-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H9N3S/c1-7-6-10-12-13-11(15)14(10)9-5-3-2-4-8(7)9/h2-6H,1H3,(H,13,15)
