36120-58-8 Usage
General Description
1-(2-methyl-3-hydroxy-5-hydroxymethyl-4-pyridyl)-6,7-dihydroxy-1,2-3,4-tetrahydroisoquinoline is a chemical compound that consists of a pyridine ring attached to a tetrahydroisoquinoline ring. It also contains hydroxyl and methyl groups, which provide the molecule with its distinctive properties. 1-(2-methyl-3-hydroxy-5-hydroxymethyl-4-pyridyl)-6,7-dihydroxy-1,2-3,4-tetrahydroisoquinoline has potential pharmacological applications due to its structural features, which may make it suitable for use in drug development. The presence of hydroxyl and methyl groups suggests that it could exhibit antioxidant and neuroprotective activities, making it a promising candidate for further research and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 36120-58-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,1,2 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 36120-58:
(7*3)+(6*6)+(5*1)+(4*2)+(3*0)+(2*5)+(1*8)=88
88 % 10 = 8
So 36120-58-8 is a valid CAS Registry Number.
InChI:InChI=1/C16H18N2O4/c1-8-16(22)14(10(7-19)6-18-8)15-11-5-13(21)12(20)4-9(11)2-3-17-15/h4-6,15,17,19-22H,2-3,7H2,1H3
