36343-81-4 Usage
General Description
4-Cyclohexene-1,2-dicarboxylic acid, bis(oxiranylmethyl) ester, homopolymer is a large, complex molecule derived from cyclic chemical compounds. It is synthesized from 4-Cyclohexene-1,2-dicarboxylic acid and oxiranylmethyl, forming a polymer structure through a repeating unit of the monomer, hence the term "homopolymer". Due to its unique properties, it is often used in industrial applications, such as producing various types of resins, plastics, and coatings. However, it must be carefully handled due to potential health and environmental hazards, including skin and eye irritation, and harm to the aquatic environment.
Check Digit Verification of cas no
The CAS Registry Mumber 36343-81-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,3,4 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 36343-81:
(7*3)+(6*6)+(5*3)+(4*4)+(3*3)+(2*8)+(1*1)=114
114 % 10 = 4
So 36343-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H18O6/c15-13(19-7-9-5-17-9)11-3-1-2-4-12(11)14(16)20-8-10-6-18-10/h1-2,9-12H,3-8H2