36438-97-8 Usage
General Description
1-Methyl-1,2,3,4-tetrahydro-quinoxaline dihydrochloride is a chemical compound that is commonly used as a pharmaceutical intermediate in the synthesis of various drugs. It is a dihydrochloride salt of a quinoxaline derivative, which is a heterocyclic compound containing a nitrogen atom in its ring structure. 1-METHYL-1,2,3,4-TETRAHYDRO-QUINOXALINE DIHYDROCHLORIDE is typically used in the development of pharmaceuticals for various therapeutic applications, particularly for its potential to act on the central nervous system. Its molecular structure and properties make it suitable for use in drug synthesis, and it is often employed by pharmaceutical companies and research laboratories in the development of new medications. Overall, 1-Methyl-1,2,3,4-tetrahydro-quinoxaline dihydrochloride plays a key role in the pharmaceutical industry as an intermediate in drug synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 36438-97-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,4,3 and 8 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 36438-97:
(7*3)+(6*6)+(5*4)+(4*3)+(3*8)+(2*9)+(1*7)=138
138 % 10 = 8
So 36438-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2/c1-11-7-6-10-8-4-2-3-5-9(8)11/h2-5,10H,6-7H2,1H3