36590-19-9 Usage
Description
4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide is a thiourea derivative resulting from the formal condensation of the secondary amino group of 1-methylpiperazine and the primary amino group of N-(4-nitrophenyl)benzene-1,4-diamine with carbonothioic O,O-acid. It is a complex organic compound with potential applications in various fields due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide is used as a pharmaceutical compound for its potential therapeutic applications. 4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide's unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs to treat various diseases.
Used in Chemical Research:
In the field of chemical research, 4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide serves as a valuable compound for studying the properties and reactivity of thiourea derivatives. Its synthesis and characterization can provide insights into the development of new synthetic methods and the exploration of novel chemical reactions.
Used in Material Science:
4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide can be utilized in material science as a component in the development of new materials with specific properties. Its unique chemical structure may contribute to the creation of materials with enhanced performance in areas such as electronics, sensors, or advanced materials for various applications.
Used in Analytical Chemistry:
As an analytical chemistry tool, 4-Methyl-N-[4-[(4-nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide can be employed as a reagent or a reference compound in the development of new analytical methods or the improvement of existing ones. Its distinct chemical properties may enable the detection, quantification, or separation of specific target molecules in complex samples.
Originator
CGP 6140,CIBA-GEIGY Corp.
Manufacturing Process
A solution of 4-nitro-4'-isothiocyanodiphenylamine in toluene was treated at
50°C with stirring with a solution N-methylpiperazine in toluene. After 3 hours
the solution was filtered from the precipitate obtained. By recrystallization the
crude product from methanol the 4-methyl-N-[4-[(4-
nitrophenyl)amino]phenyl]-1-piperazinecarbothioamide was obtained; melting
point 191-196°C.
Therapeutic Function
Anthelmintic
Check Digit Verification of cas no
The CAS Registry Mumber 36590-19-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,6,5,9 and 0 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 36590-19:
(7*3)+(6*6)+(5*5)+(4*9)+(3*0)+(2*1)+(1*9)=129
129 % 10 = 9
So 36590-19-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H21N5O2S/c1-21-10-12-22(13-11-21)18(26)20-16-4-2-14(3-5-16)19-15-6-8-17(9-7-15)23(24)25/h2-9,19H,10-13H2,1H3,(H,20,26)