372-44-1 Usage
General Description
Phenol-boron trifluoride is a chemical compound composed of phenol, which is a type of aromatic organic compound, and boron trifluoride, a chemical compound of boron and fluorine. When combined, these two chemicals form a stabilized phenol-boron trifluoride complex, which is often used as a catalyst in organic synthesis and polymerization reactions. The complex is known for its ability to facilitate the formation of carbon-carbon and carbon-oxygen bonds, making it a valuable tool in the production of various chemical and pharmaceutical products. Additionally, phenol-boron trifluoride is commonly used in the manufacturing of resins, plastics, and adhesives, due to its role in promoting the cross-linking of polymers.
Check Digit Verification of cas no
The CAS Registry Mumber 372-44-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 3,7 and 2 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 372-44:
(5*3)+(4*7)+(3*2)+(2*4)+(1*4)=61
61 % 10 = 1
So 372-44-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H3F3O.B/c7-3-1-2-4(10)6(9)5(3)8;/h1-2,10H;
