37470-46-5 Usage
Description
4-Hydroxy-3-iodobenzoic acid is an organic compound characterized by the presence of a hydroxyl group at the 4-position and an iodine atom at the 3-position on a benzene ring. It exhibits unique chemical properties due to the presence of these functional groups, making it a versatile molecule for various applications in the chemical and pharmaceutical industries.
Uses
Used in Chemical Synthesis:
4-Hydroxy-3-iodobenzoic acid is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for selective reactions and transformations, making it a valuable building block for the development of new molecules with potential applications in various fields.
Used in Pharmaceutical Industry:
4-Hydroxy-3-iodobenzoic acid is used as a precursor in the synthesis of pharmaceutical compounds. Its ability to undergo enantioselective cross-electrophile aryl-alkenylation of unactivated alkenes enables the creation of chiral molecules with potential therapeutic applications. This process is crucial for the development of enantiomerically pure drugs, which can have improved efficacy and reduced side effects compared to their racemic counterparts.
Used in Enantioselective Synthesis:
4-Hydroxy-3-iodobenzoic acid is used as a reactant in enantioselective cross-electrophile aryl-alkenylation reactions. This process allows for the selective formation of one enantiomer over the other, which is essential for the production of enantiomerically pure compounds. Enantioselective synthesis is particularly important in the pharmaceutical industry, as the different enantiomers of a drug can have different biological activities and side effect profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 37470-46-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,4,7 and 0 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 37470-46:
(7*3)+(6*7)+(5*4)+(4*7)+(3*0)+(2*4)+(1*6)=125
125 % 10 = 5
So 37470-46-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H5IO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,(H,10,11)
37470-46-5Relevant articles and documents
Active Site Binding Is Not Sufficient for Reductive Deiodination by Iodotyrosine Deiodinase
Ingavat, Nattha,Kavran, Jennifer M.,Sun, Zuodong,Rokita, Steven E.
, p. 1130 - 1139 (2017)
The minimal requirements for substrate recognition and turnover by iodotyrosine deiodinase were examined to learn the basis for its catalytic specificity. This enzyme is crucial for iodide homeostasis and the generation of thyroid hormone in chordates. 2-
Imidazole-containing condensed tricyclic compound and application thereof
-
Paragraph 0114, (2018/03/01)
The invention discloses an imidazole-containing condensed tricyclic compound adopting the structure as shown in the formula (I) or pharmaceutically acceptable salts, stereisomers or prodrug molecules thereof. The imidazole-containing condensed tricyclic compound has the IDO1 activity regulation function, can enhance T-cell activation through blocking immune checkpoints IDO1, is used for treating IDO1-mediated immunosuppression, and therefore, can become an effective medicine for treating malignant tumors. When used together with checkpoint protein anti-body drugs or other anti-cancer drugs, the imidazole-containing condensed tricyclic compound can enhance the anti-cancer effect. Meanwhile, the imidazole-containing condensed tricyclic compound has the potential of effectively treating IDO1 abnormity related immunosuppressive diseases and has a high application value.
Heterocyclic modulators of cannabinoid receptors
-
Page/Page column 32-33; 34-35, (2016/06/06)
Heterocyclic compounds which modulate cannabinoid receptors are presented. Pharmaceutical compositions containing these compounds, methods of using these compounds as modulators of cannabinoid receptors and processes for synthesizing these compounds are a
