37672-74-5 Usage
Benzamido group
Aromatic amide functional group consisting of a carbonyl group (C=O) bonded to a benzene ring and an amine group (NH2).
Diazenyl-phenyl group
Aromatic diazenyl (azo) group consisting of two nitrogen atoms connected by a single bond (N-N) attached to a phenyl ring.
Chloro substituent
A chlorine atom (Cl) attached to the 2-position of the 2-chloro-4-nitro-phenyl group, which may influence the compound's reactivity and properties.
Nitro substituents
Two nitro groups (-NO2) attached to the 4-position of the 2-chloro-4-nitro-phenyl group, which can impart explosive properties and contribute to the compound's potential use as a dye or in drug development.
Benzoyloxyethyl group
An ester functional group consisting of a carbonyl group (C=O) bonded to a benzene ring and an ethylene glycol group (CH2-CH2-O).
Ethyl benzoate group
An ester functional group consisting of a carbonyl group (C=O) bonded to a benzene ring and an ethyl group (CH3-CH2-).
Complex molecular structure
The compound has a complex structure with multiple functional groups, making it a versatile molecule with potential applications in various fields.
Potential pharmaceutical applications
Due to the presence of the 2-chloro-4-nitro-phenyl group, the compound may have potential uses in the pharmaceutical industry, possibly as a dye or in the development of new drugs.
Further investigation required
The synthesis and potential uses of this compound would need to be further explored to fully understand its properties and potential applications in medicine, chemistry, and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 37672-74-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,6,7 and 2 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 37672-74:
(7*3)+(6*7)+(5*6)+(4*7)+(3*2)+(2*7)+(1*4)=145
145 % 10 = 5
So 37672-74-5 is a valid CAS Registry Number.
InChI:InChI=1/C37H30ClN5O7/c38-31-24-30(43(47)48)17-18-32(31)40-41-33-19-16-29(25-34(33)39-35(44)26-10-4-1-5-11-26)42(20-22-49-36(45)27-12-6-2-7-13-27)21-23-50-37(46)28-14-8-3-9-15-28/h1-19,24-25H,20-23H2,(H,39,44)/b41-40+