3781-93-9 Usage
Description
2,3-DIMETHYLBENZOFURAN-5-CARBOXYLIC ACID is a carboxylic acid derivative belonging to the benzofuran family. It is a chemical compound that features a carboxyl functional group and is known for its potential pharmacological properties, such as anti-inflammatory and anti-cancer effects. This versatile compound finds applications in both research and industry.
Used in Pharmaceutical Industry:
2,3-DIMETHYLBENZOFURAN-5-CARBOXYLIC ACID is used as an intermediate in the synthesis of various drugs and pharmaceutical products. Its unique structure and functional group contribute to the development of new therapeutic agents.
Used in Research:
2,3-DIMETHYLBENZOFURAN-5-CARBOXYLIC ACID is used as a subject of study for its potential pharmacological properties. Researchers are interested in exploring its anti-inflammatory and anti-cancer effects, which could lead to the discovery of novel treatments for various diseases.
Used in Chemical Synthesis:
2,3-DIMETHYLBENZOFURAN-5-CARBOXYLIC ACID is used as a building block in the synthesis of complex organic compounds. Its reactivity and functional group make it a valuable component in creating new molecules with specific properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 3781-93-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,7,8 and 1 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 3781-93:
(6*3)+(5*7)+(4*8)+(3*1)+(2*9)+(1*3)=109
109 % 10 = 9
So 3781-93-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H10O3/c1-6-7(2)14-10-4-3-8(11(12)13)5-9(6)10/h3-5H,1-2H3,(H,12,13)
