37959-11-8 Usage
Description
(5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID is a chemical compound with the molecular formula C11H10N2O3. It is a derivative of pyrazole and belongs to the class of organic compounds known as pyrazoles. (5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID contains a phenyl group, a pyrazole ring, and a carboxylic acid group, making it an effective intermediate for the synthesis of various pharmaceuticals and bioactive molecules. It is also used as a building block in organic synthesis and in medicinal chemistry for the development of new drugs. (5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID's structural and functional properties make it a valuable resource in drug discovery and development.
Used in Pharmaceutical Industry:
(5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID is used as an intermediate for the synthesis of various pharmaceuticals and bioactive molecules. Its unique structure and functional groups make it a promising candidate for the development of new drugs.
Used in Organic Synthesis:
(5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID is used as a building block in organic synthesis. Its phenyl group, pyrazole ring, and carboxylic acid group provide a versatile platform for the creation of new organic compounds.
Used in Medicinal Chemistry:
(5-OXO-1-PHENYL-2,5-DIHYDRO-1H-PYRAZOL-3-YL)ACETIC ACID is used in medicinal chemistry for the development of new drugs. Its structural and functional properties make it a valuable resource in drug discovery and development, contributing to the advancement of pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 37959-11-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,7,9,5 and 9 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 37959-11:
(7*3)+(6*7)+(5*9)+(4*5)+(3*9)+(2*1)+(1*1)=158
158 % 10 = 8
So 37959-11-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c14-10-6-8(7-11(15)16)12-13(10)9-4-2-1-3-5-9/h1-6,12H,7H2,(H,15,16)
