380396-49-6 Usage
General Description
Piperidin-4-ylmethyl-pyridin-2-yl-amine hydrochloride is a chemical compound that includes elements such as nitrogen, hydrogen, and carbon in addition to a hydrochloride group. It can be characterized by its molecular formula which can be determined by the number and arrangements of these atoms. The compound is likely to exist as a crystalline solid, similar to many organic based hydrochlorides. It's naming indicates the presence of a piperidine and a pyridine ring in its structure, which could suggest potential applications in various areas of chemical synthesis and research due to the prominent role these structures play in many pharmacologically active compounds. However, specific properties such as melting point, boiling point, density and solubility would need to be determined experimentally. Its safety profile, toxicological information and possible hazards are also not commonly known and should be thoroughly researched and understood before handling this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 380396-49-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,0,3,9 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 380396-49:
(8*3)+(7*8)+(6*0)+(5*3)+(4*9)+(3*6)+(2*4)+(1*9)=166
166 % 10 = 6
So 380396-49-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3.ClH/c1-2-6-13-11(3-1)14-9-10-4-7-12-8-5-10;/h1-3,6,10,12H,4-5,7-9H2,(H,13,14);1H
