380430-52-4 Usage
General Description
3-Benzyloxycarbonylphenylboronic acid is a chemical compound used as a building block in organic synthesis. It contains a boronic acid functional group, which is a versatile tool for forming carbon-carbon and carbon-heteroatom bonds in organic reactions. 3-BENZYLOXYCARBONYLPHENYLBORONIC ACID is commonly used in the Suzuki-Miyaura coupling reaction, where it acts as a source of the aryl (phenyl) group. Additionally, the benzyloxycarbonyl protective group allows for selective manipulation of other functional groups in the molecule during synthesis. Overall, 3-Benzyloxycarbonylphenylboronic acid is a valuable reagent in organic chemistry for constructing complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 380430-52-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,8,0,4,3 and 0 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 380430-52:
(8*3)+(7*8)+(6*0)+(5*4)+(4*3)+(3*0)+(2*5)+(1*2)=124
124 % 10 = 4
So 380430-52-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H13BO4/c16-14(19-10-11-5-2-1-3-6-11)12-7-4-8-13(9-12)15(17)18/h1-9,17-18H,10H2
