39825-23-5 Usage
Description
Bisorcic, also known as N-acetyl-L-ornithine, is an N-acetyl-L-amino acid derived from L-ornithine with two acetyl substituents at positions N-2 and N-5. It is a bioactive compound with potential applications in various industries due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
Bisorcic is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs.
Used in Cosmetic Industry:
Bisorcic is used as an active ingredient in cosmetics for its potential skin benefits. Its ability to interact with biopolymers and macromolecules may contribute to improved skin health and appearance.
Used in Research and Development:
Bisorcic is used as a research compound for studying its interactions with various biological systems. This can help in understanding its potential applications and developing new therapeutic strategies.
Used in Nutritional Supplements:
Bisorcic may be used as an ingredient in nutritional supplements for its potential health benefits. Its unique properties could contribute to overall well-being and support specific physiological functions.
Check Digit Verification of cas no
The CAS Registry Mumber 39825-23-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,8,2 and 5 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 39825-23:
(7*3)+(6*9)+(5*8)+(4*2)+(3*5)+(2*2)+(1*3)=145
145 % 10 = 5
So 39825-23-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H16N2O4/c1-6(12)10-5-3-4-8(9(14)15)11-7(2)13/h8H,3-5H2,1-2H3,(H,10,12)(H,11,13)(H,14,15)/t8-/m0/s1
