40258-72-8 Usage
General Description
Methyl 3-Bromo-4-hydroxy-5-nitrobenzenecarboxylate is a chemical compound with the molecular formula C8H6BrNO6. It is characterized by the incorporation of bromine, hydroxy, nitro, and carboxylate functional groups in its structure which contribute to its unique properties. The compound falls under the category of organic compounds known as benzoic acid and derivatives. These are compounds containing a benzoic acid moiety, which consists of a benzene ring bearing a carboxyl group. The presence of these chemical groups can allow this compound to participate in various chemical reactions, often acting as a powerful reagent in organic synthesis reactions. As a research chemical, it is typically used in laboratories rather than commercial or industrial applications. Always handle it with care due to its reactive nature and potential hazards associated with it.
Check Digit Verification of cas no
The CAS Registry Mumber 40258-72-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,0,2,5 and 8 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 40258-72:
(7*4)+(6*0)+(5*2)+(4*5)+(3*8)+(2*7)+(1*2)=98
98 % 10 = 8
So 40258-72-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H6BrNO5/c1-15-8(12)4-2-5(9)7(11)6(3-4)10(13)14/h2-3,11H,1H3