414881-63-3 Usage
General Description
1-(1H-Indol-3-ylmethyl)-4-piperidinol is a chemical compound with the molecular formula C14H18N2O. It is a derivative of piperidinol with an indole group attached to the piperidine ring. 1-(1H-Indol-3-ylmethyl)-4-piperidinol has been studied for its potential pharmaceutical properties, including its potential use as a psychoactive drug or as an intermediate in the synthesis of other chemical compounds. It is also known for its ability to modulate certain receptors in the brain, and it has been the subject of research for its potential in treating various neurological and psychiatric conditions. The compound's specific mechanisms of action and potential therapeutic uses are still being investigated.
Check Digit Verification of cas no
The CAS Registry Mumber 414881-63-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,1,4,8,8 and 1 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 414881-63:
(8*4)+(7*1)+(6*4)+(5*8)+(4*8)+(3*1)+(2*6)+(1*3)=153
153 % 10 = 3
So 414881-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H18N2O/c17-12-5-7-16(8-6-12)10-11-9-15-14-4-2-1-3-13(11)14/h1-4,9,12,15,17H,5-8,10H2