4215-99-0 Usage
Description
6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione is a chemical compound characterized by its brilliant green-blue color. It is soluble in 1,2,3,4-tetrahydronaphthalene and xylene. 6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione exhibits different colors when exposed to various chemical solutions, such as orange in concentrated sulfuric acid, red-orange in basic insurance powder solution, and yellow-brown in acidic insurance powder solution.
Uses
Used in Textile Industry:
6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione is used as a dye in the textile industry for its vibrant color and solubility in certain solvents. Its color-changing properties in different chemical solutions make it suitable for various applications, such as creating unique color effects or responding to specific chemical treatments.
Used in Analytical Chemistry:
6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione's color-changing properties in different chemical solutions can be utilized in analytical chemistry for detecting or measuring the presence of specific chemicals or conditions. For example, it can be used as an indicator in titrations or as a sensor for detecting certain substances.
Used in Research and Development:
6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione can be used in research and development for studying the properties and behavior of chemical compounds, particularly those related to color changes and solubility. This can lead to the discovery of new applications or improvements in existing ones.
Standard:
6-amino-10,12-dichloronaphth[2,3-c]acridine-5,8,14(13H)-trione has been tested and assigned a standard for various properties, such as ironing fastness, chlorine bleach, light fastness, mercerized, oxygen bleach, and soaping. The ratings for these properties range from 3 to 8, indicating their performance and suitability for different applications.
Preparation
(a) C.I. Vat Violet 14 (C.I. 67895) with 4-Methylbenzenesulfonamide?sulfonamide and hydrolyzed; (b) 1-Amino-4-bromo-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid with 3-Amino-4-chlorobenzoic acid and 3,5-Dichloroanthranilic acid mixture processing, then remove sulfonic group and cyclization.
Standard
Ironing Fastness
Fading
Stain
ISO
4-5
Check Digit Verification of cas no
The CAS Registry Mumber 4215-99-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,2,1 and 5 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4215-99:
(6*4)+(5*2)+(4*1)+(3*5)+(2*9)+(1*9)=80
80 % 10 = 0
So 4215-99-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H10Cl2N2O3/c22-8-5-11-17(13(23)6-8)25-18-12(19(11)26)7-14(24)15-16(18)21(28)10-4-2-1-3-9(10)20(15)27/h1-7H,24H2,(H,25,26)