4318-68-7 Usage
Description
3,4-Pyridinediamine, 5-nitrois an organic compound with the chemical formula C5H6N4O2. It is a derivative of pyridine, which is a heterocyclic compound with a nitrogen atom in the ring structure. The presence of two amine groups (-NH2) at the 3rd and 4th positions, along with a nitro group (-NO2) at the 5th position, gives this compound unique chemical properties and reactivity.
Uses
Used in Pharmaceutical Industry:
3,4-Pyridinediamine, 5-nitrois used as a reagent for the efficient synthesis of 2-Fluoroalkylbenzimidazoles and -benzothiazoles. These compounds have potential applications in the development of new drugs and therapeutic agents, as they can exhibit various biological activities, such as anti-inflammatory, anti-cancer, and anti-microbial properties.
Used in Chemical Synthesis:
In the field of organic chemistry, 3,4-Pyridinediamine, 5-nitrocan be used as a building block or intermediate for the synthesis of more complex molecules. Its unique functional groups allow for various chemical reactions, such as nucleophilic substitution, electrophilic aromatic substitution, and reductive amination, which can lead to the formation of novel compounds with diverse applications.
Used in Research and Development:
3,4-Pyridinediamine, 5-nitrocan also be utilized in research and development for the study of chemical reactions, mechanisms, and the development of new synthetic methods. Its unique structure and reactivity make it an interesting candidate for exploring new reaction pathways and understanding the fundamental principles of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 4318-68-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,3,1 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 4318-68:
(6*4)+(5*3)+(4*1)+(3*8)+(2*6)+(1*8)=87
87 % 10 = 7
So 4318-68-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N4O2/c6-3-1-8-2-4(5(3)7)9(10)11/h1-2H,6H2,(H2,7,8)
