442910-92-1 Usage
General Description
7-Fluoro-5-Methyl Isatin is a chemical compound with the molecular formula C9H6FNO2. It is a derivative of isatin, a heterocyclic compound with a bicyclic structure. 7-Fluoro-5-Methyl Isatin is used in the synthesis of various pharmaceuticals and agrochemicals. It is also known for its potential biological activities, including anti-inflammatory, antimicrobial and anticancer properties. The presence of a fluoro group in the molecule enhances its reactivity and biological activity, making it a promising candidate for the development of new drugs and chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 442910-92-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,4,2,9,1 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 442910-92:
(8*4)+(7*4)+(6*2)+(5*9)+(4*1)+(3*0)+(2*9)+(1*2)=141
141 % 10 = 1
So 442910-92-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H6FNO2/c1-4-2-5-7(6(10)3-4)11-9(13)8(5)12/h2-3H,1H3,(H,11,12,13)
