469887-83-0 Usage
General Description
(S)-2-Amino-1-(3-chlorophenyl)ethanol hydrochloride is a chemical compound consisting of a hydrochloride salt of the amino alcohol (S)-2-amino-1-(3-chlorophenyl)ethanol. It is commonly used as a chiral building block in the synthesis of pharmaceuticals and agrochemicals. The compound is a white to off-white powder that is soluble in water and ethanol. It has a molecular formula of C8H11ClNO?HCl and a molecular weight of 202.13 g/mol. This chemical has applications in the pharmaceutical industry, particularly in the development of new drugs due to its chiral nature and ability to form various derivatives. Additionally, (S)-2-Amino-1-(3-chlorophenyl)ethanol hydrochloride is also used as a research reagent in various scientific studies.
Check Digit Verification of cas no
The CAS Registry Mumber 469887-83-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,6,9,8,8 and 7 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 469887-83:
(8*4)+(7*6)+(6*9)+(5*8)+(4*8)+(3*7)+(2*8)+(1*3)=240
240 % 10 = 0
So 469887-83-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H10ClNO.ClH/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-4,8,11H,5,10H2;1H/t8-;/m1./s1
