4711-06-2 Usage
Description
(1R,2S,3R)-(2-Quinoxalinyl)-1,2,3,4-butanetetrol is a complex organic compound characterized by its unique stereochemistry and quinoxaline ring structure. It is a chiral molecule with specific configurations at the first, second, and third carbon atoms, which play a crucial role in its properties and potential applications.
Uses
Used in Pharmaceutical Industry:
(1R,2S,3R)-(2-Quinoxalinyl)-1,2,3,4-butanetetrol is used as an intermediate in the synthesis of 2-Quinoxalinecarboxylic Acid (Q765265), which is a residue of Carbadox (C175825). Carbadox is an antimicrobial drug used in the veterinary industry for the treatment of bacterial infections in animals. (1R,2S,3R)-(2-Quinoxalinyl)-1,2,3,4-butanetetrol's role in the synthesis of this antimicrobial agent highlights its importance in the development of pharmaceuticals for animal health.
Additionally, given its structural features and potential for further chemical modification, (1R,2S,3R)-(2-Quinoxalinyl)-1,2,3,4-butanetetrol may have other applications in the pharmaceutical industry, such as serving as a building block for the development of new drugs with various therapeutic properties. However, further research and development would be required to explore these potential applications fully.
Check Digit Verification of cas no
The CAS Registry Mumber 4711-06-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,1 and 1 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4711-06:
(6*4)+(5*7)+(4*1)+(3*1)+(2*0)+(1*6)=72
72 % 10 = 2
So 4711-06-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O4/c15-6-10(16)12(18)11(17)9-5-13-7-3-1-2-4-8(7)14-9/h1-5,10-12,15-18H,6H2/t10-,11-,12+/m1/s1
4711-06-2Relevant articles and documents
Degradation of glucose: reinvestigation of reactive α-dicarbonyl compounds
Jenny, Gobert,Glomb, Marcus A.
experimental part, p. 8591 - 8597 (2010/07/15)
Maillard reactions influence the formation of flavor and color in processed foods in an important way. Reducing sugars and amino acids ultimately react to stable end products. To elucidate the complex formation pathways a vast number of experiments have b
Quinoxalines Derived from D-Glucose and O-Phenylenediamine in Weakly Acidic Medium
Morita, Naofumi,Inoue, Keiichi,Takagi, Masanosuke
, p. 2665 - 2668 (2007/10/02)
-