4737-50-2 Usage
Description
N-Pentylboronic Acid, also known as 1-pentylboronic acid, is an organic compound with the chemical formula C5H11BO2H. It is a colorless liquid that is soluble in water and has a characteristic boron-oxygen bond. N-PENTYLBORONIC ACID is a versatile reagent in organic synthesis and has unique properties due to its boron atom, which can form stable covalent bonds with carbon, oxygen, and other elements.
Uses
Used in Pharmaceutical Industry:
N-Pentylboronic Acid is used as a synthetic intermediate for the production of various pharmaceutical compounds. It plays a crucial role in the synthesis of (-)-Δ8-tetrahydrocannabinol (THC) and (-)-Δ9-tetrahydrocannabinol (THC), which are the primary psychoactive compounds found in cannabis. These compounds have potential therapeutic applications in treating various medical conditions, such as chronic pain, epilepsy, and multiple sclerosis.
Used in Biochemical Research:
N-Pentylboronic Acid is also used as a reagent in the synthesis of boronic acid inhibitors of endothelial lipase. Endothelial lipase is an enzyme involved in the regulation of high-density lipoprotein (HDL) cholesterol levels. Inhibition of this enzyme can potentially lead to the development of new therapeutic agents for the treatment of cardiovascular diseases and other conditions related to lipid metabolism.
Check Digit Verification of cas no
The CAS Registry Mumber 4737-50-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,3 and 7 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 4737-50:
(6*4)+(5*7)+(4*3)+(3*7)+(2*5)+(1*0)=102
102 % 10 = 2
So 4737-50-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H13BO2/c1-2-3-4-5-6(7)8/h7-8H,2-5H2,1H3
