478-13-7 Usage
Uses
1. Used in Pharmaceutical Industry:
(13R,13aR)-5,8,13,13a-Tetrahydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-13β-ol is used as a pharmaceutical compound for its potential therapeutic applications. (13R,13aR)-5,8,13,13a-Tetrahydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-13β-ol's unique structure and properties make it a promising candidate for the development of new drugs, particularly in the treatment of various diseases and conditions.
2. Used in Chemical Research:
(13R,13aR)-5,8,13,13a-Tetrahydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-13β-ol is also used in chemical research for studying the properties and reactions of protoberberine alkaloids. Its complex structure and various functional groups make it an interesting subject for research in organic chemistry, potentially leading to the discovery of new synthetic pathways and applications.
3. Used in Natural Product Analysis:
As a major constituent of Corydalis ophiocarpa Hook, (13R,13aR)-5,8,13,13a-Tetrahydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-13β-ol is used in the analysis and identification of natural products. Its presence in the plant can be used to characterize and authenticate the source material, ensuring the quality and purity of extracts and derivatives used in the pharmaceutical and cosmetic industries.
4. Used in Drug Synthesis:
(13R,13aR)-5,8,13,13a-Tetrahydro-9,10-dimethoxy-6H-benzo[g]-1,3-benzodioxolo[5,6-a]quinolizin-13β-ol's unique structure and functional groups make it a valuable starting material for the synthesis of new drugs and pharmaceutical agents. Its potential use in drug synthesis can lead to the development of novel therapeutics with improved efficacy and reduced side effects.
References
Manske., Can. J. Res., 17B, 51 (1939)Govindachari, Rajaduvai., J. Chern. Soc., 557 (1957)Ohta, Toni, Morozumi., Tetrahedron Lett., 859 (1963)
Check Digit Verification of cas no
The CAS Registry Mumber 478-13-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,7 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 478-13:
(5*4)+(4*7)+(3*8)+(2*1)+(1*3)=77
77 % 10 = 7
So 478-13-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H21NO5/c1-23-15-4-3-12-14(20(15)24-2)9-21-6-5-11-7-16-17(26-10-25-16)8-13(11)18(21)19(12)22/h3-4,7-8,18-19,22H,5-6,9-10H2,1-2H3