478043-89-9 Usage
Description
3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine is a heterocyclic chemical compound with the molecular formula C11H8BrN3O. It features a fused imidazole and pyrimidine ring system, along with a 4-methoxyphenyl group attached at the 2-position. 3-BROMO-2-(4-METHOXY-PHENYL)-IMIDAZO[1,2-A]PYRIMIDINE is frequently utilized in research and drug development due to its potential pharmacological activities, which may include anti-cancer and anti-inflammatory properties. It holds significant interest for medicinal chemists and pharmaceutical researchers due to its potential therapeutic benefits in treating a range of diseases.
Uses
Used in Pharmaceutical Research and Development:
3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine is used as a compound of interest for its potential anti-cancer properties, making it a candidate for the development of new cancer therapeutics. Its specific application in this field is due to its ability to target and potentially inhibit the growth of cancer cells.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine is used as a structural template to design and synthesize new drugs with improved pharmacological profiles. Its unique structure allows for modifications that can enhance its therapeutic effects and reduce side effects.
Used in Anti-Inflammatory Applications:
3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine is also considered for its potential anti-inflammatory properties, which could make it useful in the treatment of various inflammatory conditions. Its application in this area is based on the compound's ability to modulate inflammatory responses, providing relief and potentially leading to the development of new anti-inflammatory medications.
Used in Drug Discovery:
As a part of drug discovery processes, 3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine is used in high-throughput screening assays to identify its potential interactions with biological targets. This can lead to the discovery of new drugs with specific therapeutic applications.
Used in Academic Research:
In academic research settings, 3-Bromo-2-(4-methoxy-phenyl)-imidazo[1,2-a]pyrimidine serves as a subject of study to understand its pharmacological properties, mechanism of action, and potential side effects. This research can contribute to the advancement of knowledge in medicinal chemistry and pharmacology, aiding in the development of safer and more effective drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 478043-89-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,8,0,4 and 3 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 478043-89:
(8*4)+(7*7)+(6*8)+(5*0)+(4*4)+(3*3)+(2*8)+(1*9)=179
179 % 10 = 9
So 478043-89-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H10BrN3O/c1-18-10-5-3-9(4-6-10)11-12(14)17-8-2-7-15-13(17)16-11/h2-8H,1H3