498-59-9 Usage
Description
DJENKOLIC ACID, also known as a dithioacetal, is a unique compound consisting of two molecules of L-cysteine joined together through their sulfanyl groups to a methylene group. This structure grants DJENKOLIC ACID distinct chemical properties and potential applications across various industries.
Uses
Used in Pharmaceutical Industry:
DJENKOLIC ACID is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs and therapies.
Used in Chemical Synthesis:
In the chemical industry, DJENKOLIC ACID can be utilized as a key intermediate or building block in the synthesis of various complex organic molecules. Its dithioacetal structure provides a versatile platform for further chemical modifications and the creation of novel compounds with specific properties.
Used in Research and Development:
DJENKOLIC ACID serves as an important research tool in the field of biochemistry and molecular biology. Its unique properties make it a valuable probe for studying the interactions between biomolecules and understanding the underlying mechanisms of various biological processes.
Purification Methods
Crystallise djenkolic acid from a large volume of water (solubility is 0.5g%). [du Vigneaud & Patterson J Biol Chem 114 533 1936, Greenstein & Winitz The Chemistry of the Amino Acids J. Wiley, Vol 3 pp 2682, 2687 1961, Beilstein 4 III 1591.] The N,N’-dibenzoyl derivative crystallises with 1H2O from aqueous EtOH with m 87.5-89o [Beilstein 9 III 1171.]
Check Digit Verification of cas no
The CAS Registry Mumber 498-59-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,9 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 498-59:
(5*4)+(4*9)+(3*8)+(2*5)+(1*9)=99
99 % 10 = 9
So 498-59-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H14N2O4S2/c8-4(6(10)11)1-14-3-15-2-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)
