50606-58-1 Usage
Description
1-Benzyl-3-piperidone hydrochloride is an organic compound with the chemical formula C12H16ClNO and is characterized by its cream to pale brown powder appearance. It is a derivative of piperidone, which is a heterocyclic compound with potential applications in various fields due to its chemical properties.
Uses
1-Benzyl-3-piperidone hydrochloride is used as an intermediate in the synthesis of various organic compounds, particularly in the pharmaceutical industry. Its role as a building block allows for the creation of more complex molecules with specific therapeutic properties.
Used in Pharmaceutical Industry:
1-Benzyl-3-piperidone hydrochloride is used as a synthetic intermediate for the development of novel pharmaceutical compounds. Its structural properties make it a valuable component in the design and synthesis of new drugs, potentially leading to the discovery of treatments for various medical conditions.
Used in Chemical Research:
1-Benzyl-3-piperidone hydrochloride is also utilized in chemical research as a starting material for the exploration of new chemical reactions and the synthesis of innovative molecules. Its unique structure provides researchers with opportunities to study its reactivity and potential applications in various chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 50606-58-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,6,0 and 6 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50606-58:
(7*5)+(6*0)+(5*6)+(4*0)+(3*6)+(2*5)+(1*8)=101
101 % 10 = 1
So 50606-58-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H15NO.ClH/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11;/h1-3,5-6H,4,7-10H2;1H
