50765-21-4 Usage
General Description
3-hydroxy-5-iodobenzoic acid is a chemical compound that belongs to the class of aromatic carboxylic acids. It is a derivative of benzoic acid, with a hydroxyl group and an iodine atom attached to the benzene ring. 3-hydroxy-5-iodobenzoic acid is commonly used as an intermediate in the synthesis of pharmaceuticals and organic chemicals. Its hydroxy and carboxylic acid functional groups make it a potential candidate for various chemical reactions and derivatization. Additionally, the presence of the iodine atom introduces unique reactivity, making 3-hydroxy-5-iodobenzoic acid a valuable building block for the preparation of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 50765-21-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,6 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 50765-21:
(7*5)+(6*0)+(5*7)+(4*6)+(3*5)+(2*2)+(1*1)=114
114 % 10 = 4
So 50765-21-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5IO3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,9H,(H,10,11)