50910-54-8 Usage
Description
Trans-4-Aminocyclohexanol hydrochloride is an organic compound with the chemical formula C6H13NO·HCl. It is a white to off-white solid and is known for its potential applications in the pharmaceutical and chemical industries.
Uses
1. Pharmaceutical Industry:
Trans-4-Aminocyclohexanol hydrochloride is used as a starting material for the preparation of potential hypertensive agents and other biologically active compounds. Its unique chemical structure allows it to be a valuable component in the development of new drugs targeting high blood pressure and other related conditions.
2. Chemical Synthesis:
In the field of chemical synthesis, trans-4-Aminocyclohexanol hydrochloride serves as a key intermediate in the synthesis of various complex organic molecules. Specifically, it has been used in the synthesis of:
a. N-substituted 7-azabicyclo[2.2.1]heptanes via transannular nucleophilic displacement. These compounds have potential applications in the development of novel pharmaceuticals and other specialty chemicals.
b. Trans-4-methoxyoxalamido-1-cyclohexanolbenzoxazine, which is required for the preparation of polybenzoxazine-silica hybrid nanocomposites. These nanocomposites have potential applications in the materials science field, particularly in the development of advanced polymers with improved properties.
Check Digit Verification of cas no
The CAS Registry Mumber 50910-54-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,9,1 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 50910-54:
(7*5)+(6*0)+(5*9)+(4*1)+(3*0)+(2*5)+(1*4)=98
98 % 10 = 8
So 50910-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO.ClH/c7-5-1-3-6(8)4-2-5;/h5-6,8H,1-4,7H2;1H/t5-,6+;