51325-95-2 Usage
Description
4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-ylvinyl)-4H-pyran is a complex organic compound characterized by its unique molecular structure. It is a derivative of pyran, a heterocyclic compound with a six-membered ring containing one oxygen atom, and features a dicyanomethylene group, a methyl group, and a julolidin-4-ylvinyl group. 4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-ylvinyl)-4H-pyran is known for its potential applications in various fields due to its specific chemical and physical properties.
Uses
Used in Organic Light-Emitting Devices (OLEDs):
4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-ylvinyl)-4H-pyran is used as a key component in the fabrication of white organic light-emitting devices (WOLEDs). Its application is based on the combination of a fluorescent sub-monolayer with a phosphorescent doping layer, which allows for the creation of highly efficient and bright light-emitting devices. 4-(Dicyanomethylene)-2-methyl-6-(julolidin-4-ylvinyl)-4H-pyran's unique properties contribute to the overall performance and color quality of the WOLEDs, making it a valuable material in the field of optoelectronics and display technology.
Check Digit Verification of cas no
The CAS Registry Mumber 51325-95-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,3,2 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 51325-95:
(7*5)+(6*1)+(5*3)+(4*2)+(3*5)+(2*9)+(1*5)=102
102 % 10 = 2
So 51325-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C23H21N3O/c1-16-10-20(21(14-24)15-25)13-22(27-16)7-6-17-11-18-4-2-8-26-9-3-5-19(12-17)23(18)26/h6-7,10-13H,2-5,8-9H2,1H3