5176-95-4 Usage
Description
2-chloro-N4,6-dimethylpyrimidine-4,5-diamine is a pyrimidine derivative chemical compound that is widely recognized for its antiviral and antitumor properties. It is a promising candidate in the pharmaceutical industry due to its potential to inhibit the growth of certain cancer cells and viruses, making it a valuable asset in the development of new therapeutic agents.
Uses
Used in Pharmaceutical Industry:
2-chloro-N4,6-dimethylpyrimidine-4,5-diamine is used as an active pharmaceutical ingredient for the development of antiviral and antitumor medications. Its antiviral activity is attributed to its ability to inhibit the replication of certain viruses, while its antitumor properties stem from its capacity to hinder the growth of specific cancer cells.
Used in Medicinal Chemistry Research:
2-chloro-N4,6-dimethylpyrimidine-4,5-diamine is utilized as a key compound in medicinal chemistry research, where its chemical structure and properties are further explored and optimized to enhance its therapeutic potential. This research aims to improve the efficacy and safety of drugs targeting viral infections and cancer treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 5176-95-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,7 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5176-95:
(6*5)+(5*1)+(4*7)+(3*6)+(2*9)+(1*5)=104
104 % 10 = 4
So 5176-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H9ClN4/c1-3-4(8)5(9-2)11-6(7)10-3/h8H2,1-2H3,(H,9,10,11)
