52386-11-5 Usage
General Description
4(1H)-Pyrimidinone, 6-amino-2-chloro- (9CI) is a chemical compound with the molecular formula C4H3ClN2O. It belongs to the pyrimidine class of compounds and is characterized by a pyrimidine ring structure with an amino group at the 6th carbon and a chlorine substituent at the 2nd carbon. 4(1H)-Pyrimidinone, 6-amino-2-chloro- (9CI) has potential applications in pharmaceutical and chemical industries, as it can serve as a building block for the synthesis of various compounds with biological and industrial significance. It may also have potential use as an intermediate in the synthesis of drugs and agrochemicals. Additionally, its properties and reactivity make it a valuable tool for research in organic chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 52386-11-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,8 and 6 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 52386-11:
(7*5)+(6*2)+(5*3)+(4*8)+(3*6)+(2*1)+(1*1)=115
115 % 10 = 5
So 52386-11-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H4ClN3O/c5-4-7-2(6)1-3(9)8-4/h1H,(H3,6,7,8,9)
