5399-87-1 Usage
Description
6-Chloropurine riboside is a colorless crystalline powder that serves as a significant compound in the field of biochemistry and molecular biology. It is a modified nucleoside derivative, which plays a crucial role in various research applications and the synthesis of other nucleoside compounds.
Uses
Used in Biochemical Research:
6-Chloropurine riboside is used as a substrate analogue in the study of the kinetics and substrate specificity of adenosine deaminase, an enzyme that plays a vital role in the immune system and purine metabolism.
Used in Synthesis of Nucleoside Derivatives:
6-Chloropurine riboside is benzoylated to facilitate the synthesis of nucleoside derivatives, such as 9-(2,3-Di-deoxy-2-fluoro-β-D-threo-pentofuranosyl)adenine, which are essential for the development of new therapeutic agents and understanding the structure-activity relationships of nucleosides.
Used in Enzyme Studies:
6-Chloropurine riboside, particularly after phosphorylation to NMP, NDP, or NTP, is employed as a purine substrate analogue in research involving enzymes like Inosine monophosphate dehydrogenase (IMPDH), bacteriophage T4 RNA-ligase (EC 6.5.1.3), and pancreatic fibonuclease A. These studies contribute to the understanding of enzyme mechanisms, regulation, and potential applications in drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 5399-87-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,9 and 9 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5399-87:
(6*5)+(5*3)+(4*9)+(3*9)+(2*8)+(1*7)=131
131 % 10 = 1
So 5399-87-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H11ClN4O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2/t4-,6-,7-,10?/m1/s1
