54286-78-1 Usage
General Description
2-Acetamido-6-phenyl-4-pyrimidinone is a chemical compound with the molecular formula C13H11N3O2. It is a pyrimidine derivative with a phenyl substituent at the 6-position and an acetamido group at the 2-position. 2-ACETAMIDO-6-PHENYL-4-PYRIMIDINONE has potential pharmaceutical applications due to its ability to inhibit the biosynthesis of nucleic acids in microorganisms, making it a potential antibacterial and antitumor agent. Additionally, it has been studied for its potential use in the treatment of diabetes, as it has shown to have inhibitory effects on the enzyme aldose reductase, which is involved in the development of diabetic complications. Its chemical structure and potential biological activities make 2-acetamido-6-phenyl-4-pyrimidinone an interesting compound for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 54286-78-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,2,8 and 6 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 54286-78:
(7*5)+(6*4)+(5*2)+(4*8)+(3*6)+(2*7)+(1*8)=141
141 % 10 = 1
So 54286-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H11N3O2/c1-8(16)13-12-14-10(7-11(17)15-12)9-5-3-2-4-6-9/h2-7H,1H3,(H2,13,14,15,16,17)