5438-68-6 Usage
Description
2-Acetyloxy-2-phenyl-acetic acid, also known as O-Acetyl Mandelic Acid, is an organic compound with the molecular formula C10H10O4. It is a derivative of mandelic acid, featuring an acetyloxy and a phenyl group attached to the acetic acid backbone. 2-Acetyloxy-2-phenyl-acetic acid is known for its potential applications in various chemical and pharmaceutical processes due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
2-Acetyloxy-2-phenyl-acetic acid is used as a reagent for the synthesis of hindered triazolopyridinone derivatives, which are important in the development of new pharmaceutical compounds. These derivatives have potential applications in the treatment of various diseases and disorders, making O-Acetyl Mandelic Acid a valuable component in the drug discovery process.
Used in Chemical Synthesis:
In the field of organic chemistry, 2-Acetyloxy-2-phenyl-acetic acid serves as a key intermediate in the synthesis of various complex organic molecules. Its unique structure allows for further functionalization and modification, making it a versatile building block for creating novel compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 5438-68-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 8 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 5438-68:
(6*5)+(5*4)+(4*3)+(3*8)+(2*6)+(1*8)=106
106 % 10 = 6
So 5438-68-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O4/c1-7(11)14-9(10(12)13)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,12,13)/p-1/t9-/m0/s1
