55476-36-3 Usage
General Description
5-(Diethylamino)uracil, also known as decoyinine, is a synthetic chemical compound that belongs to the class of uracil derivatives. It is a potent inhibitor of the enzyme uridine monophosphate kinase, which plays a crucial role in the biosynthesis of RNA and DNA. 5-(Diethylamino)uracil has shown promise in research as a potential anticancer agent, as it interferes with the proliferation of cancer cells by disrupting their ability to synthesize nucleic acids. Additionally, it has been studied for its potential use in antiviral and antiparasitic treatments. However, further research is needed to fully understand its therapeutic potential and to evaluate its safety and efficacy for medical use.
Check Digit Verification of cas no
The CAS Registry Mumber 55476-36-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,7 and 6 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55476-36:
(7*5)+(6*5)+(5*4)+(4*7)+(3*6)+(2*3)+(1*6)=143
143 % 10 = 3
So 55476-36-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H13N3O2/c1-3-11(4-2)6-5-9-8(13)10-7(6)12/h5H,3-4H2,1-2H3,(H2,9,10,12,13)
