5578-82-5 Usage
Description
1,4-Dioxacyclotetradecane-5,14-dione, also known as Glycerol, is a simple polyol compound that is widely used in various industries due to its unique properties. It is a colorless, odorless, and viscous liquid with a sweet taste. Glycerol is a versatile compound with three hydroxyl groups, which allows it to form hydrogen bonds and interact with various substances. This characteristic makes it a valuable component in numerous applications.
Uses
Used in Medical Goods:
1,4-Dioxacyclotetradecane-5,14-dione is used as a key component in the production of various medical goods. Its properties make it suitable for use in pharmaceutical formulations, as a humectant in cosmetics, and as a solvent in the manufacturing of drugs and other healthcare products. Glycerol's ability to interact with other substances and its compatibility with the human body contribute to its widespread use in the medical industry.
Used in Polymer Identification:
1,4-Dioxacyclotetradecane-5,14-dione is employed as an additive in the identification of additives in polymers from single-use bioprocessing bags. 1,4-Dioxacyclotetradecane-5,14-dione plays a crucial role in the accelerated solvent extraction and ultra-high performance liquid chromatography coupled with high-resolution mass spectrometry process. This technique is used to analyze and identify additives in polymers, which is essential for ensuring the safety and quality of bioprocessing bags and their contents.
Check Digit Verification of cas no
The CAS Registry Mumber 5578-82-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,7 and 8 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5578-82:
(6*5)+(5*5)+(4*7)+(3*8)+(2*8)+(1*2)=125
125 % 10 = 5
So 5578-82-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O4/c13-11-7-5-3-1-2-4-6-8-12(14)16-10-9-15-11/h1-10H2
