56311-37-6 Usage
General Description
5-Ethyl-furan-2-carboxylic acid is a chemical compound with the molecular formula C7H8O3. It is a furan derivative, containing a furan ring with a carboxylic acid group and an ethyl substituent. 5-Ethyl-furan-2-carboxylic acid has potential applications in the pharmaceutical and food industries, where it may be used as a building block for the synthesis of various bioactive compounds and flavoring agents. It is also known for its potential antioxidant and anti-inflammatory properties. Additionally, 5-Ethyl-furan-2-carboxylic acid has attracted interest in the field of organic chemistry due to its role as an important intermediate in the synthesis of various pharmaceuticals and natural products.
Check Digit Verification of cas no
The CAS Registry Mumber 56311-37-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,3,1 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56311-37:
(7*5)+(6*6)+(5*3)+(4*1)+(3*1)+(2*3)+(1*7)=106
106 % 10 = 6
So 56311-37-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O3/c1-2-5-3-4-6(10-5)7(8)9/h3-4H,2H2,1H3,(H,8,9)
