56654-53-6 Usage
Properties & Specific Content of 1-Butyl-3,3-dimethyl-1-nitrosourea (BDMNU)
A chemical compound consisting of 7 carbon atoms, 14 hydrogen atoms, 2 nitrogen atoms, and 2 oxygen atoms.
2. Nitrosourea derivative
A compound derived from the nitrosourea class, which includes alkylating agents known for their mutagenic and carcinogenic properties.
3. Common use in scientific research
BDMNU is often used as a carcinogen and mutagen to induce tumors in experimental animals for studying cancer, cytogenetics, and mutagenesis.
4. Application in pharmaceutical industry
Utilized in the synthesis of anticancer drugs due to its ability to cross the blood-brain barrier and target cancer cells in the central nervous system.
5. Potent alkylating agent
BDMNU forms DNA adducts, leading to DNA damage and cell death, making it an effective agent in the development of anticancer drugs.
6. Hazardous nature
Due to its mutagenic and carcinogenic properties, BDMNU should be handled and stored with caution to prevent exposure and contamination.
Check Digit Verification of cas no
The CAS Registry Mumber 56654-53-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,6,5 and 4 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56654-53:
(7*5)+(6*6)+(5*6)+(4*5)+(3*4)+(2*5)+(1*3)=146
146 % 10 = 6
So 56654-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H15N3O2/c1-4-5-6-10(8-12)7(11)9(2)3/h4-6H2,1-3H3
56654-53-6Relevant articles and documents
N-Nitroso- and N-Nitrotrialkylureas and Their Decomposition
White, Emil H.,Ryan, Thomas J.,Hahn, Bo Sup,Erickson, Ronald H.
, p. 4860 - 4866 (2007/10/02)
The synthesis and decomposition of N-(n-butyl)-N',N'-dimethyl-N-nitrosourea (2a), N-(n-butyl)-N',N'-dimethyl-N-nitrourea (3a), N',N'-dimethyl N-(1-norbornyl)-N-nitrosourea (2b), N',N'-dimethyl-N-(1-norbornyl)-N-nitrourea (3b) are described.Several of the compounds show complex NMR spectra ascribable to rotational isomerism.Decomposition of 2a and 3a gave n-butyl N,N-dimethylcarbamate and tetramethylurea, while decompostion of 2b and 3b in methylene chloride gave 1-norbornyl N,N-dimethylcarbamate and 1-norbornyl chloride.These products are formed via diazotic acid derivatives and carbonium ion pairs; the reaction mechanism is essentially the same as that established for the closely related N-nitrosoamides.In concentrated solutions, nitrosourea 2a yielded a new product, amino acid 20.