56961-77-4 Usage
Description
1-Bromo-2,3-dichlorobenzene is an organic compound with the chemical formula C6H3BrCl2. It is a brominated and chlorinated derivative of benzene, featuring one bromine atom and two chlorine atoms attached to the benzene ring. 1-Bromo-2,3-dichlorobenzene is known for its reactivity and is commonly used as a synthetic intermediate in the production of various chemicals and pharmaceuticals.
Uses
1. Used in Pharmaceutical Industry:
1-Bromo-2,3-dichlorobenzene is used as a reagent for the preparation of selective nonpeptidic inhibitors of striatal-enriched protein tyrosine phosphatase (SHP-2). These inhibitors play a crucial role in regulating cellular signaling pathways and have potential applications in the treatment of various diseases, including cancer and neurological disorders.
2. Used in Chemical Synthesis:
1-Bromo-2,3-dichlorobenzene serves as an important intermediate in the synthesis of various organic compounds, such as dyes, pesticides, and other specialty chemicals. Its unique structure allows for further functionalization and modification, making it a versatile building block in the chemical industry.
3. Used in Material Science:
1-Bromo-2,3-dichlorobenzene's properties, such as its reactivity and stability, make it suitable for use in the development of new materials with specific characteristics. For instance, it can be used in the synthesis of polymers with tailored properties for applications in various industries, such as electronics, automotive, and aerospace.
4. Used in Research and Development:
1-Bromo-2,3-dichlorobenzene is also utilized in academic and industrial research settings to study the effects of bromination and chlorination on the chemical and physical properties of benzene and its derivatives. This knowledge can be applied to the design and development of new compounds with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 56961-77-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,9,6 and 1 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 56961-77:
(7*5)+(6*6)+(5*9)+(4*6)+(3*1)+(2*7)+(1*7)=164
164 % 10 = 4
So 56961-77-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrCl2/c7-4-2-1-3-5(8)6(4)9/h1-3H
56961-77-4Relevant articles and documents
Traynham
, p. 2213,2214 (1976)
Isomerization of bromohalogenobenzenes
-
, (2008/06/13)
Bromohalogenobenzenes are isomerized to useful, e.g., pharmaceutical or phytosanitary intermediates, by contacting the same with an alkaline base and a catalyst compound which forms a complex with the cation of said alkaline base.