57905-31-4 Usage
Description
4-HYDROXY-NICOTINIC ACID ETHYL ESTER, also known as Ethyl 4-Hydroxynicotinate, is the ethyl ester derivative of 4-Hydroxynicotinic Acid (H952780). It is a compound with potential applications in the pharmaceutical and chemical industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
4-HYDROXY-NICOTINIC ACID ETHYL ESTER is used as a reagent for the synthesis and biological evaluation of novel imidazo[4,5-c]pyridinecarboxamide derivatives. These derivatives serve as PARP-1 inhibitors and antitumor agents, playing a crucial role in the development of new cancer treatments.
Used in Chemical Synthesis:
4-HYDROXY-NICOTINIC ACID ETHYL ESTER is used as a key intermediate in the synthesis of various chemical compounds, particularly those with potential applications in the pharmaceutical industry. Its unique structure allows for further modification and functionalization, making it a valuable building block in the development of new drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 57905-31-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,7,9,0 and 5 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 57905-31:
(7*5)+(6*7)+(5*9)+(4*0)+(3*5)+(2*3)+(1*1)=144
144 % 10 = 4
So 57905-31-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO3/c1-2-12-8(11)6-5-9-4-3-7(6)10/h3-5H,2H2,1H3,(H,9,10)
