5810-42-4 Usage
Description
Tetrapropyl ammonium chloride, also known as Tetra-n-propylammonium chloride, is a solid organic compound with the chemical formula (C3H7)4NCl. It is a quaternary ammonium salt that is widely used in various applications due to its unique properties.
Uses
Tetrapropyl ammonium chloride is used as a phase-transfer catalyst in various chemical reactions. It facilitates the transfer of reactants between two immiscible phases, such as between an aqueous and an organic phase, enhancing the reaction rate and efficiency.
Used in Chemical Industry:
Tetrapropyl ammonium chloride is used as a phase-transfer catalyst for various chemical reactions, including organic synthesis, hydrolysis, and esterification. Its ability to transfer reactants between immiscible phases allows for faster reaction rates and improved product yields.
Used in Analytical Chemistry:
In analytical chemistry, Tetrapropyl ammonium chloride is employed as an extractant for the separation and purification of various compounds. It can selectively extract specific analytes from complex mixtures, making it a valuable tool for sample preparation and analysis.
Used in Environmental Applications:
Tetrapropyl ammonium chloride is utilized in the treatment of wastewater and soil remediation. It can help remove heavy metals and other contaminants from polluted environments, contributing to a cleaner and safer ecosystem.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Tetrapropyl ammonium chloride is used as an intermediate in the synthesis of various drugs and active pharmaceutical ingredients. Its unique properties make it a versatile building block for the development of new medications.
Used in Material Science:
Tetrapropyl ammonium chloride is also used in the development of novel materials, such as ionic liquids and polymers. These materials have potential applications in energy storage, catalysis, and other advanced technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 5810-42-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,8,1 and 0 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5810-42:
(6*5)+(5*8)+(4*1)+(3*0)+(2*4)+(1*2)=84
84 % 10 = 4
So 5810-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H16N2O3S/c1-27-19-12-11-14-7-5-6-10-16(14)17(19)13-18-20(25)23-22(28)24(21(18)26)15-8-3-2-4-9-15/h2-13H,1H3,(H,23,25,28)/b18-13-