5963-14-4 Usage
Description
8-METHYLNONANOIC ACID is a mixture of branched-chain acids, primarily consisting of trimethylheptanoic and dimethyloctanoic acids. It is a clear colorless to yellow liquid with unique chemical properties that make it suitable for various applications across different industries.
Uses
Used in Chemical Industry:
8-METHYLNONANOIC ACID is used as an intermediate for the production of metal salts. Its branched-chain structure allows for the formation of complex compounds that can be utilized in various chemical processes.
Used in Lubricant Industry:
8-METHYLNONANOIC ACID is used as a component in the synthesis of ester-type lubricants. Its branched-chain structure contributes to the improved performance and efficiency of these lubricants, making them suitable for various mechanical applications.
Used in Plastics Industry:
8-METHYLNONANOIC ACID is used as a plasticizer, enhancing the flexibility and workability of plastics. Its incorporation into the plastic matrix improves the overall properties of the material, making it more suitable for a wide range of applications.
Used in Pharmaceutical Industry:
8-METHYLNONANOIC ACID can be used for terminal chain branching in fatty alcohols and acids, which has shown to enhance the transdermal permeation. This property makes it a valuable component in the development of pharmaceutical formulations for improved drug delivery through the skin.
Used in Biotechnology:
8-METHYLNONANOIC ACID can be used for the synthesis of novel bacterial fatty acids, such as 16-methyl-8(Z)-heptadecenoic Acid. These novel fatty acids have potential applications in various biotechnological processes, including the production of biofuels and bioplastics.
Check Digit Verification of cas no
The CAS Registry Mumber 5963-14-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,9,6 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5963-14:
(6*5)+(5*9)+(4*6)+(3*3)+(2*1)+(1*4)=114
114 % 10 = 4
So 5963-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H20O2/c1-9(2)7-5-3-4-6-8-10(11)12/h9H,3-8H2,1-2H3,(H,11,12)/p-1
