59686-39-4 Usage
Description
ETHYL 2-CHLORO-4-METHYL-6-TETRAHYDRO-1H-PYRROL-1-YLBENZOATE is an organic compound that belongs to the class of benzoate esters. It is characterized by a molecular formula of C16H18ClNO2 and a molecular weight of 289.77 g/mol. This chemical substance is recognized for its potential as a building block in the production of various biologically active molecules, with its chlorine atom and methyl group contributing to its reactivity and functional properties.
Uses
Used in Pharmaceutical Industry:
ETHYL 2-CHLORO-4-METHYL-6-TETRAHYDRO-1H-PYRROL-1-YLBENZOATE is used as a key intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of biologically active molecules. Its unique structure allows for the creation of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical sector, ETHYL 2-CHLORO-4-METHYL-6-TETRAHYDRO-1H-PYRROL-1-YLBENZOATE serves as a crucial component in the production of agrochemicals, where its reactivity and functional groups are utilized to create compounds that can protect crops and enhance agricultural productivity.
Used in Fine Chemicals Synthesis:
ETHYL 2-CHLORO-4-METHYL-6-TETRAHYDRO-1H-PYRROL-1-YLBENZOATE is also utilized in the synthesis of other fine chemicals, where its structural features are employed to produce specialty chemicals for various applications, including but not limited to fragrances, dyes, and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 59686-39-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,6,8 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59686-39:
(7*5)+(6*9)+(5*6)+(4*8)+(3*6)+(2*3)+(1*9)=184
184 % 10 = 4
So 59686-39-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H18ClNO2/c1-3-18-14(17)13-11(15)8-10(2)9-12(13)16-6-4-5-7-16/h8-9H,3-7H2,1-2H3
