600-33-9 Usage
General Description
Chloromalonic acid is a vital organochloride compound with structural formula CC1. It's mostly recognized for its role as an essential intermediate chemical that is used in industrial applications. It is primarily used in the synthesis of other more complex chemical compounds such as barbiturates, vitamin B6, and some herbicides. The chemical chloromalonic acid is an organic compound, characterized by its reactivity and acidic nature due to the carboxyl groups present in its structure. Additionally, it helps in the generation of heterocyclic compounds, particularly its derivates that are crucial in the pharmaceutical and agrochemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 600-33-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,0 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 600-33:
(5*6)+(4*0)+(3*0)+(2*3)+(1*3)=39
39 % 10 = 9
So 600-33-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H3ClO4/c4-1(2(5)6)3(7)8/h1H,(H,5,6)(H,7,8)