60899-34-5 Usage
Description
2,3-dihydro-1-oxo-1H-indene-4-carbonitrile is an organic compound with the molecular formula C9H7NO. It is a derivative of indene, featuring a carbonitrile group at the 4-position and a dihydro structure. 2,3-dihydro-1-oxo-1H-indene-4-carbonitrile is known for its potential applications in the pharmaceutical and chemical industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
2,3-dihydro-1-oxo-1H-indene-4-carbonitrile is used as a reagent for the preparation of imidazoindenopyrazinone carboxylic acid derivatives. These derivatives exhibit anticonvulsant activity and serve as AMPA antagonists, which are crucial in the development of treatments for various neurological disorders, such as epilepsy and other conditions involving excessive neuronal activity.
Used in Chemical Synthesis:
In the chemical industry, 2,3-dihydro-1-oxo-1H-indene-4-carbonitrile can be utilized as an intermediate in the synthesis of various complex organic molecules. Its unique structural features make it a valuable building block for creating novel compounds with potential applications in different fields, such as materials science, agrochemistry, and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 60899-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,8,9 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 60899-34:
(7*6)+(6*0)+(5*8)+(4*9)+(3*9)+(2*3)+(1*4)=155
155 % 10 = 5
So 60899-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO/c11-6-7-2-1-3-9-8(7)4-5-10(9)12/h1-3H,4-5H2