61220-33-5 Usage
Description
PIPERIDIN-4-YL-UREA HCL is a chemical compound that features a piperidine ring connected to a urea molecule with a hydrogen chloride salt. It is widely recognized in medicinal chemistry as a fundamental building block for the synthesis of a variety of pharmaceutical compounds. PIPERIDIN-4-YL-UREA HCL exhibits a range of pharmacological activities and has been the subject of research for its potential roles as an analgesic, antipsychotic, and antiviral agent. The distinctive structure and biological properties of PIPERIDIN-4-YL-UREA HCL render it an indispensable asset in the realm of drug discovery and development. Moreover, it also serves as a flexible intermediate in organic synthesis, facilitating the creation of intricate organic molecules.
Uses
Used in Pharmaceutical Industry:
PIPERIDIN-4-YL-UREA HCL is utilized as a key building block for the synthesis of various pharmaceutical compounds. Its incorporation into these compounds is attributed to its diverse pharmacological activities, which include potential applications as an analgesic to alleviate pain, an antipsychotic to treat psychiatric disorders, and an antiviral agent to combat viral infections.
Used in Organic Synthesis:
In the field of organic synthesis, PIPERIDIN-4-YL-UREA HCL is employed as a versatile intermediate. This role is crucial for the preparation of complex organic molecules, where its unique structure allows for the development of advanced chemical entities with specific functionalities and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 61220-33-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,2,2 and 0 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 61220-33:
(7*6)+(6*1)+(5*2)+(4*2)+(3*0)+(2*3)+(1*3)=75
75 % 10 = 5
So 61220-33-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H13N3O.ClH/c7-6(10)9-5-1-3-8-4-2-5;/h5,8H,1-4H2,(H3,7,9,10);1H