61827-71-2 Usage
General Description
2-Amino-6-chlorobenzothiazole hydrochloride is a chemical compound that belongs to the benzothiazole family. It is a white powder with a molecular formula of C7H6ClN2S?HCl. 2-AMINO-6-CHLOROBENZOTHIAZOLE HYDROCHLORIDE is widely used in organic synthesis and as a building block for the production of pharmaceuticals, agrochemicals, and dyes. It is known for its antimicrobial, antifungal, and antitumor properties, and is commonly used in the development of anticancer drugs. Additionally, it is used as a reagent and catalyst in various chemical reactions. 2-Amino-6-chlorobenzothiazole hydrochloride is considered to be a valuable compound in the field of organic chemistry and drug discovery due to its versatile and important applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 61827-71-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,2 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 61827-71:
(7*6)+(6*1)+(5*8)+(4*2)+(3*7)+(2*7)+(1*1)=132
132 % 10 = 2
So 61827-71-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN2S.ClH/c8-4-1-2-5-6(3-4)11-7(9)10-5;/h1-3H,(H2,9,10);1H
